About 8-bromo-3,4-dihydro-1H-naphthalen-2-one;2-(2-bromophenyl)acetyl chloride
8-bromo-3,4-dihydro-1H-naphthalen-2-one;2-(2-bromophenyl)acetyl chloride (PubChem CID 159949584) has the molecular formula C18H15Br2ClO2
and a molecular weight of 458.58 g/mol. Its IUPAC name is 8-bromo-3,4-dihydro-1H-naphthalen-2-one;2-(2-bromophenyl)acetyl chloride.
Molecular Properties
| Compound Name | 8-bromo-3,4-dihydro-1H-naphthalen-2-one;2-(2-bromophenyl)acetyl chloride |
| PubChem CID | 159949584 |
| Molecular Formula | C18H15Br2ClO2 |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 455.91 |
| IUPAC Name | 8-bromo-3,4-dihydro-1H-naphthalen-2-one;2-(2-bromophenyl)acetyl chloride |
| SMILES | O=C(Cl)Cc1ccccc1Br.O=C1CCc2cccc(Br)c2C1 |
| InChI | InChI=1S/C10H9BrO.C8H6BrClO/c11-10-3-1-2-7-4-5-8(12)6-9(7)10;9-7-4-2-1-3-6(7)5-8(10)11/h1-3H,4-6H2;1-4H,5H2 |
| InChIKey | OBXXFPFMAHHOIT-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 8-bromo-3,4-dihydro-1H-naphthalen-2-one;2-(2-bromophenyl)acetyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-3,4-dihydro-1H-naphthalen-2-one;2-(2-bromophenyl)acetyl chloride?
The IUPAC name of 8-bromo-3,4-dihydro-1H-naphthalen-2-one;2-(2-bromophenyl)acetyl chloride (CID 159949584) is 8-bromo-3,4-dihydro-1H-naphthalen-2-one;2-(2-bromophenyl)acetyl chloride.
What is the SMILES notation for 8-bromo-3,4-dihydro-1H-naphthalen-2-one;2-(2-bromophenyl)acetyl chloride?
The canonical SMILES for 8-bromo-3,4-dihydro-1H-naphthalen-2-one;2-(2-bromophenyl)acetyl chloride is O=C(Cl)Cc1ccccc1Br.O=C1CCc2cccc(Br)c2C1.
What is the InChIKey of 8-bromo-3,4-dihydro-1H-naphthalen-2-one;2-(2-bromophenyl)acetyl chloride?
The InChIKey is OBXXFPFMAHHOIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrO.C8H6BrClO/c11-10-3-1-2-7-4-5-8(12)6-9(7)10;9-7-4-2-1-3-6(7)5-8(10)11/h1-3H,4-6H2;1-4H,5H2.
What are the key properties of 8-bromo-3,4-dihydro-1H-naphthalen-2-one;2-(2-bromophenyl)acetyl chloride?
8-bromo-3,4-dihydro-1H-naphthalen-2-one;2-(2-bromophenyl)acetyl chloride has a molecular weight of 458.58 g/mol, XLogP of 5.26, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-3,4-dihydro-1H-naphthalen-2-one;2-(2-bromophenyl)acetyl chloride is sourced from PubChem (CID 159949584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).