C18H15Br2ClO2 — CID 159949584
8-bromo-3,4-dihydro-1H-naphthalen-2-one;2-(2-bromophenyl)acetyl chloride (PubChem CID 159949584) has the molecular formula C18H15Br2ClO2 and a molecular weight of 458.58 g/mol. Its IUPAC name is 8-bromo-3,4-dihydro-1H-naphthalen-2-one;2-(2-bromophenyl)acetyl chloride.
| Compound Name | 8-bromo-3,4-dihydro-1H-naphthalen-2-one;2-(2-bromophenyl)acetyl chloride |
|---|---|
| PubChem CID | 159949584 |
| Molecular Formula | C18H15Br2ClO2 |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 455.91 |
| IUPAC Name | 8-bromo-3,4-dihydro-1H-naphthalen-2-one;2-(2-bromophenyl)acetyl chloride |
| SMILES | O=C(Cl)Cc1ccccc1Br.O=C1CCc2cccc(Br)c2C1 |
| InChI | InChI=1S/C10H9BrO.C8H6BrClO/c11-10-3-1-2-7-4-5-8(12)6-9(7)10;9-7-4-2-1-3-6(7)5-8(10)11/h1-3H,4-6H2;1-4H,5H2 |
| InChIKey | OBXXFPFMAHHOIT-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|