C11H11BrO2 — CID 173141263
1-(2-bromophenyl)pentane-2,3-dione (PubChem CID 173141263) has the molecular formula C11H11BrO2 and a molecular weight of 255.11 g/mol. Its IUPAC name is 1-(2-bromophenyl)pentane-2,3-dione.
| Compound Name | 1-(2-bromophenyl)pentane-2,3-dione |
|---|---|
| PubChem CID | 173141263 |
| Molecular Formula | C11H11BrO2 |
| Molecular Weight | 255.11 g/mol |
| Exact Mass | 253.99 |
| IUPAC Name | 1-(2-bromophenyl)pentane-2,3-dione |
| SMILES | CCC(=O)C(=O)Cc1ccccc1Br |
| InChI | InChI=1S/C11H11BrO2/c1-2-10(13)11(14)7-8-5-3-4-6-9(8)12/h3-6H,2,7H2,1H3 |
| InChIKey | WOHFTSPBQGHJJO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.11 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|