About 2-(2-bromophenyl)acetyl bromide
2-(2-bromophenyl)acetyl bromide (PubChem CID 87290551) has the molecular formula C8H6Br2O
and a molecular weight of 277.94 g/mol. Its IUPAC name is 2-(2-bromophenyl)acetyl bromide.
Molecular Properties
| Compound Name | 2-(2-bromophenyl)acetyl bromide |
| PubChem CID | 87290551 |
| Molecular Formula | C8H6Br2O |
| Molecular Weight | 277.94 g/mol |
| Exact Mass | 275.88 |
| IUPAC Name | 2-(2-bromophenyl)acetyl bromide |
| SMILES | O=C(Br)Cc1ccccc1Br |
| InChI | InChI=1S/C8H6Br2O/c9-7-4-2-1-3-6(7)5-8(10)11/h1-4H,5H2 |
| InChIKey | PBPLFXHHFQOSRB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.94 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-bromophenyl)acetyl bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bromophenyl)acetyl bromide?
The IUPAC name of 2-(2-bromophenyl)acetyl bromide (CID 87290551) is 2-(2-bromophenyl)acetyl bromide.
What is the SMILES notation for 2-(2-bromophenyl)acetyl bromide?
The canonical SMILES for 2-(2-bromophenyl)acetyl bromide is O=C(Br)Cc1ccccc1Br.
What is the InChIKey of 2-(2-bromophenyl)acetyl bromide?
The InChIKey is PBPLFXHHFQOSRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Br2O/c9-7-4-2-1-3-6(7)5-8(10)11/h1-4H,5H2.
What are the key properties of 2-(2-bromophenyl)acetyl bromide?
2-(2-bromophenyl)acetyl bromide has a molecular weight of 277.94 g/mol, XLogP of 2.91, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromophenyl)acetyl bromide is sourced from PubChem (CID 87290551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).