C13H11BrO2 — CID 135030725
2-[(2-bromophenyl)methyl]benzene-1,3-diol (PubChem CID 135030725) has the molecular formula C13H11BrO2 and a molecular weight of 279.13 g/mol. Its IUPAC name is 2-[(2-bromophenyl)methyl]benzene-1,3-diol.
| Compound Name | 2-[(2-bromophenyl)methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 135030725 |
| Molecular Formula | C13H11BrO2 |
| Molecular Weight | 279.13 g/mol |
| Exact Mass | 277.99 |
| IUPAC Name | 2-[(2-bromophenyl)methyl]benzene-1,3-diol |
| SMILES | Oc1cccc(O)c1Cc1ccccc1Br |
| InChI | InChI=1S/C13H11BrO2/c14-11-5-2-1-4-9(11)8-10-12(15)6-3-7-13(10)16/h1-7,15-16H,8H2 |
| InChIKey | MJIQEKDXSRTMBJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.13 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |