C11H12O2 — CID 4136021
8-methoxy-3,4-dihydro-1H-naphthalen-2-one (PubChem CID 4136021) has the molecular formula C11H12O2 and a molecular weight of 176.22 g/mol. Its IUPAC name is 8-methoxy-3,4-dihydro-1H-naphthalen-2-one.
| Compound Name | 8-methoxy-3,4-dihydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 4136021 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 8-methoxy-3,4-dihydro-1H-naphthalen-2-one |
| SMILES | COc1cccc2c1CC(=O)CC2 |
| InChI | InChI=1S/C11H12O2/c1-13-11-4-2-3-8-5-6-9(12)7-10(8)11/h2-4H,5-7H2,1H3 |
| InChIKey | BTYBORAHYUCUMH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |