C13H14O3 — CID 10751295
methyl 8-methoxy-1,4-dihydronaphthalene-2-carboxylate (PubChem CID 10751295) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is methyl 8-methoxy-1,4-dihydronaphthalene-2-carboxylate.
| Compound Name | methyl 8-methoxy-1,4-dihydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 10751295 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | methyl 8-methoxy-1,4-dihydronaphthalene-2-carboxylate |
| SMILES | COC(=O)C1=CCc2cccc(OC)c2C1 |
| InChI | InChI=1S/C13H14O3/c1-15-12-5-3-4-9-6-7-10(8-11(9)12)13(14)16-2/h3-5,7H,6,8H2,1-2H3 |
| InChIKey | KBAYHSKFHSOSHS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |