C19H26O5 — CID 158993814
butanoyl butanoate;8-methoxy-3,4-dihydro-1H-naphthalen-2-one (PubChem CID 158993814) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is butanoyl butanoate;8-methoxy-3,4-dihydro-1H-naphthalen-2-one.
| Compound Name | butanoyl butanoate;8-methoxy-3,4-dihydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 158993814 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | butanoyl butanoate;8-methoxy-3,4-dihydro-1H-naphthalen-2-one |
| SMILES | CCCC(=O)OC(=O)CCC.COc1cccc2c1CC(=O)CC2 |
| InChI | InChI=1S/C11H12O2.C8H14O3/c1-13-11-4-2-3-8-5-6-9(12)7-10(8)11;1-3-5-7(9)11-8(10)6-4-2/h2-4H,5-7H2,1H3;3-6H2,1-2H3 |
| InChIKey | JQMKHOHXRLJLHL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|