C11H11Br — CID 12507989
2-(bromomethyl)tricyclo[6.2.0.03,6]deca-1(8),2,6-triene (PubChem CID 12507989) has the molecular formula C11H11Br and a molecular weight of 223.11 g/mol. Its IUPAC name is 2-(bromomethyl)tricyclo[6.2.0.03,6]deca-1(8),2,6-triene.
| Compound Name | 2-(bromomethyl)tricyclo[6.2.0.03,6]deca-1(8),2,6-triene |
|---|---|
| PubChem CID | 12507989 |
| Molecular Formula | C11H11Br |
| Molecular Weight | 223.11 g/mol |
| Exact Mass | 222.00 |
| IUPAC Name | 2-(bromomethyl)tricyclo[6.2.0.03,6]deca-1(8),2,6-triene |
| SMILES | BrCc1c2c(cc3c1CC3)CC2 |
| InChI | InChI=1S/C11H11Br/c12-6-11-9-3-1-7(9)5-8-2-4-10(8)11/h5H,1-4,6H2 |
| InChIKey | MMJQWOFSKPJNPG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.11 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|