C10H12Br2 — CID 3015742
1,4-bis(bromomethyl)-2,5-dimethylbenzene (PubChem CID 3015742) has the molecular formula C10H12Br2 and a molecular weight of 292.01 g/mol. Its IUPAC name is 1,4-bis(bromomethyl)-2,5-dimethylbenzene.
| Compound Name | 1,4-bis(bromomethyl)-2,5-dimethylbenzene |
|---|---|
| PubChem CID | 3015742 |
| Molecular Formula | C10H12Br2 |
| Molecular Weight | 292.01 g/mol |
| Exact Mass | 289.93 |
| IUPAC Name | 1,4-bis(bromomethyl)-2,5-dimethylbenzene |
| SMILES | Cc1cc(CBr)c(C)cc1CBr |
| InChI | InChI=1S/C10H12Br2/c1-7-3-10(6-12)8(2)4-9(7)5-11/h3-4H,5-6H2,1-2H3 |
| InChIKey | MUSYLRHTIZVVCB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.01 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|