C10H14 — CID 7269
1,2,4,5-tetramethylbenzene (PubChem CID 7269) has the molecular formula C10H14 and a molecular weight of 134.22 g/mol. Its IUPAC name is 1,2,4,5-tetramethylbenzene.
| Compound Name | 1,2,4,5-tetramethylbenzene |
|---|---|
| PubChem CID | 7269 |
| Molecular Formula | C10H14 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | 1,2,4,5-tetramethylbenzene |
| SMILES | Cc1cc(C)c(C)cc1C |
| InChI | InChI=1S/C10H14/c1-7-5-9(3)10(4)6-8(7)2/h5-6H,1-4H3 |
| InChIKey | SQNZJJAZBFDUTD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |