C11H15Br — CID 10105132
3-(bromomethyl)-1,2,4,5-tetramethylbenzene (PubChem CID 10105132) has the molecular formula C11H15Br and a molecular weight of 227.14 g/mol. Its IUPAC name is 3-(bromomethyl)-1,2,4,5-tetramethylbenzene.
| Compound Name | 3-(bromomethyl)-1,2,4,5-tetramethylbenzene |
|---|---|
| PubChem CID | 10105132 |
| Molecular Formula | C11H15Br |
| Molecular Weight | 227.14 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 3-(bromomethyl)-1,2,4,5-tetramethylbenzene |
| SMILES | Cc1cc(C)c(C)c(CBr)c1C |
| InChI | InChI=1S/C11H15Br/c1-7-5-8(2)10(4)11(6-12)9(7)3/h5H,6H2,1-4H3 |
| InChIKey | IUCONKFAVHWGDH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.14 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|