C14H19ClO — CID 19362782
2-[2,6-di(propan-2-yl)phenyl]acetyl chloride (PubChem CID 19362782) has the molecular formula C14H19ClO and a molecular weight of 238.76 g/mol. Its IUPAC name is 2-[2,6-di(propan-2-yl)phenyl]acetyl chloride.
| Compound Name | 2-[2,6-di(propan-2-yl)phenyl]acetyl chloride |
|---|---|
| PubChem CID | 19362782 |
| Molecular Formula | C14H19ClO |
| Molecular Weight | 238.76 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 2-[2,6-di(propan-2-yl)phenyl]acetyl chloride |
| SMILES | CC(C)c1cccc(C(C)C)c1CC(=O)Cl |
| InChI | InChI=1S/C14H19ClO/c1-9(2)11-6-5-7-12(10(3)4)13(11)8-14(15)16/h5-7,9-10H,8H2,1-4H3 |
| InChIKey | DGDULTYJJIIHHN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.76 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|