C15H20F2O4S — CID 157189839
3-[2,6-di(propan-2-yl)phenyl]-1,1-difluoro-2-oxopropane-1-sulfonic acid (PubChem CID 157189839) has the molecular formula C15H20F2O4S and a molecular weight of 334.38 g/mol. Its IUPAC name is 3-[2,6-di(propan-2-yl)phenyl]-1,1-difluoro-2-oxopropane-1-sulfonic acid.
| Compound Name | 3-[2,6-di(propan-2-yl)phenyl]-1,1-difluoro-2-oxopropane-1-sulfonic acid |
|---|---|
| PubChem CID | 157189839 |
| Molecular Formula | C15H20F2O4S |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 3-[2,6-di(propan-2-yl)phenyl]-1,1-difluoro-2-oxopropane-1-sulfonic acid |
| SMILES | CC(C)c1cccc(C(C)C)c1CC(=O)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C15H20F2O4S/c1-9(2)11-6-5-7-12(10(3)4)13(11)8-14(18)15(16,17)22(19,20)21/h5-7,9-10H,8H2,1-4H3,(H,19,20,21) |
| InChIKey | PRHXFEOICOZKAX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|