C23H31NO2S — CID 145387579
2-[2,6-di(propan-2-yl)phenyl]-N-[4-(2-hydroxypropan-2-yl)phenyl]sulfanylacetamide (PubChem CID 145387579) has the molecular formula C23H31NO2S and a molecular weight of 385.57 g/mol. Its IUPAC name is 2-[2,6-di(propan-2-yl)phenyl]-N-[4-(2-hydroxypropan-2-yl)phenyl]sulfanylacetamide.
| Compound Name | 2-[2,6-di(propan-2-yl)phenyl]-N-[4-(2-hydroxypropan-2-yl)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 145387579 |
| Molecular Formula | C23H31NO2S |
| Molecular Weight | 385.57 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | 2-[2,6-di(propan-2-yl)phenyl]-N-[4-(2-hydroxypropan-2-yl)phenyl]sulfanylacetamide |
| SMILES | CC(C)c1cccc(C(C)C)c1CC(=O)NSc1ccc(C(C)(C)O)cc1 |
| InChI | InChI=1S/C23H31NO2S/c1-15(2)19-8-7-9-20(16(3)4)21(19)14-22(25)24-27-18-12-10-17(11-13-18)23(5,6)26/h7-13,15-16,26H,14H2,1-6H3,(H,24,25) |
| InChIKey | KFYNAFHNHJBAOG-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.57 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|