C24H32FNO3S — CID 145387580
2-[4-fluoro-2,6-di(propan-2-yl)phenyl]-N-[3-(hydroxymethyl)-4-(2-hydroxypropan-2-yl)phenyl]sulfanylacetamide (PubChem CID 145387580) has the molecular formula C24H32FNO3S and a molecular weight of 433.59 g/mol. Its IUPAC name is 2-[4-fluoro-2,6-di(propan-2-yl)phenyl]-N-[3-(hydroxymethyl)-4-(2-hydroxypropan-2-yl)phenyl]sulfanylacetamide.
| Compound Name | 2-[4-fluoro-2,6-di(propan-2-yl)phenyl]-N-[3-(hydroxymethyl)-4-(2-hydroxypropan-2-yl)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 145387580 |
| Molecular Formula | C24H32FNO3S |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 2-[4-fluoro-2,6-di(propan-2-yl)phenyl]-N-[3-(hydroxymethyl)-4-(2-hydroxypropan-2-yl)phenyl]sulfanylacetamide |
| SMILES | CC(C)c1cc(F)cc(C(C)C)c1CC(=O)NSc1ccc(C(C)(C)O)c(CO)c1 |
| InChI | InChI=1S/C24H32FNO3S/c1-14(2)19-10-17(25)11-20(15(3)4)21(19)12-23(28)26-30-18-7-8-22(24(5,6)29)16(9-18)13-27/h7-11,14-15,27,29H,12-13H2,1-6H3,(H,26,28) |
| InChIKey | LRMBGCOLWUMTFR-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|