C23H32N4O2S — CID 142490268
cyanamide;1-[2,6-di(propan-2-yl)phenyl]-3-[3-(2-hydroxypropan-2-yl)phenyl]sulfanylurea (PubChem CID 142490268) has the molecular formula C23H32N4O2S and a molecular weight of 428.60 g/mol. Its IUPAC name is cyanamide;1-[2,6-di(propan-2-yl)phenyl]-3-[3-(2-hydroxypropan-2-yl)phenyl]sulfanylurea.
| Compound Name | cyanamide;1-[2,6-di(propan-2-yl)phenyl]-3-[3-(2-hydroxypropan-2-yl)phenyl]sulfanylurea |
|---|---|
| PubChem CID | 142490268 |
| Molecular Formula | C23H32N4O2S |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | cyanamide;1-[2,6-di(propan-2-yl)phenyl]-3-[3-(2-hydroxypropan-2-yl)phenyl]sulfanylurea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)NSc1cccc(C(C)(C)O)c1.N#CN |
| InChI | InChI=1S/C22H30N2O2S.CH2N2/c1-14(2)18-11-8-12-19(15(3)4)20(18)23-21(25)24-27-17-10-7-9-16(13-17)22(5,6)26;2-1-3/h7-15,26H,1-6H3,(H2,23,24,25);2H2 |
| InChIKey | XIMWDEGBJMKUNQ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 111.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|