C23H28ClN3O2S — CID 167147932
1-[4-chloro-2,6-di(propan-2-yl)phenyl]-3-[3-cyano-5-(2-hydroxypropan-2-yl)phenyl]sulfanylurea (PubChem CID 167147932) has the molecular formula C23H28ClN3O2S and a molecular weight of 446.02 g/mol. Its IUPAC name is 1-[4-chloro-2,6-di(propan-2-yl)phenyl]-3-[3-cyano-5-(2-hydroxypropan-2-yl)phenyl]sulfanylurea.
| Compound Name | 1-[4-chloro-2,6-di(propan-2-yl)phenyl]-3-[3-cyano-5-(2-hydroxypropan-2-yl)phenyl]sulfanylurea |
|---|---|
| PubChem CID | 167147932 |
| Molecular Formula | C23H28ClN3O2S |
| Molecular Weight | 446.02 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 1-[4-chloro-2,6-di(propan-2-yl)phenyl]-3-[3-cyano-5-(2-hydroxypropan-2-yl)phenyl]sulfanylurea |
| SMILES | CC(C)c1cc(Cl)cc(C(C)C)c1NC(=O)NSc1cc(C#N)cc(C(C)(C)O)c1 |
| InChI | InChI=1S/C23H28ClN3O2S/c1-13(2)19-10-17(24)11-20(14(3)4)21(19)26-22(28)27-30-18-8-15(12-25)7-16(9-18)23(5,6)29/h7-11,13-14,29H,1-6H3,(H2,26,27,28) |
| InChIKey | ZPJHJSBHIXFTGA-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.02 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|