C15H19N3O — CID 146603384
1-[4-cyano-2,6-di(propan-2-yl)phenyl]-3-methylideneurea (PubChem CID 146603384) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is 1-[4-cyano-2,6-di(propan-2-yl)phenyl]-3-methylideneurea.
| Compound Name | 1-[4-cyano-2,6-di(propan-2-yl)phenyl]-3-methylideneurea |
|---|---|
| PubChem CID | 146603384 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 1-[4-cyano-2,6-di(propan-2-yl)phenyl]-3-methylideneurea |
| SMILES | C=NC(=O)Nc1c(C(C)C)cc(C#N)cc1C(C)C |
| InChI | InChI=1S/C15H19N3O/c1-9(2)12-6-11(8-16)7-13(10(3)4)14(12)18-15(19)17-5/h6-7,9-10H,5H2,1-4H3,(H,18,19) |
| InChIKey | SSACMDDQXJPUIB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 65.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|