C21H27FN4O3S2 — CID 153389752
CID 153389752 (PubChem CID 153389752) has the molecular formula C21H27FN4O3S2 and a molecular weight of 466.60 g/mol.
| Compound Name | CID 153389752 |
|---|---|
| PubChem CID | 153389752 |
| Molecular Formula | C21H27FN4O3S2 |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | — |
| SMILES | CC(C)c1cc(C#N)cc(C(C)C)c1NC(=O)/[N+](c1sc(C(C)(C)O)cc1F)=[S-](/N)=O |
| InChI | InChI=1S/C21H27FN4O3S2/c1-11(2)14-7-13(10-23)8-15(12(3)4)18(14)25-20(27)26(31(24)29)19-16(22)9-17(30-19)21(5,6)28/h7-9,11-12,28H,1-6H3,(H2,24,29)(H,25,27) |
| InChIKey | YAPGMMFSMYRJPN-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|