C20H26Cl2N2O2S2 — CID 145387790
1-[4-chloro-2,6-di(propan-2-yl)phenyl]-3-[5-chloro-4-(2-hydroxypropan-2-yl)thiophen-2-yl]sulfanylurea (PubChem CID 145387790) has the molecular formula C20H26Cl2N2O2S2 and a molecular weight of 461.48 g/mol. Its IUPAC name is 1-[4-chloro-2,6-di(propan-2-yl)phenyl]-3-[5-chloro-4-(2-hydroxypropan-2-yl)thiophen-2-yl]sulfanylurea.
| Compound Name | 1-[4-chloro-2,6-di(propan-2-yl)phenyl]-3-[5-chloro-4-(2-hydroxypropan-2-yl)thiophen-2-yl]sulfanylurea |
|---|---|
| PubChem CID | 145387790 |
| Molecular Formula | C20H26Cl2N2O2S2 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | 1-[4-chloro-2,6-di(propan-2-yl)phenyl]-3-[5-chloro-4-(2-hydroxypropan-2-yl)thiophen-2-yl]sulfanylurea |
| SMILES | CC(C)c1cc(Cl)cc(C(C)C)c1NC(=O)NSc1cc(C(C)(C)O)c(Cl)s1 |
| InChI | InChI=1S/C20H26Cl2N2O2S2/c1-10(2)13-7-12(21)8-14(11(3)4)17(13)23-19(25)24-28-16-9-15(18(22)27-16)20(5,6)26/h7-11,26H,1-6H3,(H2,23,24,25) |
| InChIKey | FTXYACXRVAXJTK-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|