C14H22S — CID 71264347
2-(methylsulfanylmethyl)-1,3-di(propan-2-yl)benzene (PubChem CID 71264347) has the molecular formula C14H22S and a molecular weight of 222.40 g/mol. Its IUPAC name is 2-(methylsulfanylmethyl)-1,3-di(propan-2-yl)benzene.
| Compound Name | 2-(methylsulfanylmethyl)-1,3-di(propan-2-yl)benzene |
|---|---|
| PubChem CID | 71264347 |
| Molecular Formula | C14H22S |
| Molecular Weight | 222.40 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 2-(methylsulfanylmethyl)-1,3-di(propan-2-yl)benzene |
| SMILES | CSCc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C14H22S/c1-10(2)12-7-6-8-13(11(3)4)14(12)9-15-5/h6-8,10-11H,9H2,1-5H3 |
| InChIKey | NYMJGVOUXLVBOW-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.40 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |