C14H21I — CID 155328338
2-(2-iodoethyl)-1,3-di(propan-2-yl)benzene (PubChem CID 155328338) has the molecular formula C14H21I and a molecular weight of 316.23 g/mol. Its IUPAC name is 2-(2-iodoethyl)-1,3-di(propan-2-yl)benzene.
| Compound Name | 2-(2-iodoethyl)-1,3-di(propan-2-yl)benzene |
|---|---|
| PubChem CID | 155328338 |
| Molecular Formula | C14H21I |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 2-(2-iodoethyl)-1,3-di(propan-2-yl)benzene |
| SMILES | CC(C)c1cccc(C(C)C)c1CCI |
| InChI | InChI=1S/C14H21I/c1-10(2)12-6-5-7-13(11(3)4)14(12)8-9-15/h5-7,10-11H,8-9H2,1-4H3 |
| InChIKey | PIQHNKWCGGQYKL-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|