C20H30 — CID 169110897
2-(2-cyclohex-3-en-1-ylethyl)-1,3-di(propan-2-yl)benzene (PubChem CID 169110897) has the molecular formula C20H30 and a molecular weight of 270.46 g/mol. Its IUPAC name is 2-(2-cyclohex-3-en-1-ylethyl)-1,3-di(propan-2-yl)benzene.
| Compound Name | 2-(2-cyclohex-3-en-1-ylethyl)-1,3-di(propan-2-yl)benzene |
|---|---|
| PubChem CID | 169110897 |
| Molecular Formula | C20H30 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | 2-(2-cyclohex-3-en-1-ylethyl)-1,3-di(propan-2-yl)benzene |
| SMILES | CC(C)c1cccc(C(C)C)c1CCC1CC=CCC1 |
| InChI | InChI=1S/C20H30/c1-15(2)18-11-8-12-19(16(3)4)20(18)14-13-17-9-6-5-7-10-17/h5-6,8,11-12,15-17H,7,9-10,13-14H2,1-4H3 |
| InChIKey | GFMWMSQNTOSJHX-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|