C24H37N3OS — CID 5067136
1-(cyclohex-3-en-1-ylmethyl)-3-(2-methyl-6-propan-2-ylphenyl)-1-(2-morpholin-4-ylethyl)thiourea (PubChem CID 5067136) has the molecular formula C24H37N3OS and a molecular weight of 415.65 g/mol. Its IUPAC name is 1-(cyclohex-3-en-1-ylmethyl)-3-(2-methyl-6-propan-2-ylphenyl)-1-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 1-(cyclohex-3-en-1-ylmethyl)-3-(2-methyl-6-propan-2-ylphenyl)-1-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 5067136 |
| Molecular Formula | C24H37N3OS |
| Molecular Weight | 415.65 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | 1-(cyclohex-3-en-1-ylmethyl)-3-(2-methyl-6-propan-2-ylphenyl)-1-(2-morpholin-4-ylethyl)thiourea |
| SMILES | Cc1cccc(C(C)C)c1NC(=S)N(CCN1CCOCC1)CC1CC=CCC1 |
| InChI | InChI=1S/C24H37N3OS/c1-19(2)22-11-7-8-20(3)23(22)25-24(29)27(18-21-9-5-4-6-10-21)13-12-26-14-16-28-17-15-26/h4-5,7-8,11,19,21H,6,9-10,12-18H2,1-3H3,(H,25,29) |
| InChIKey | SMTHFTRRIKPDAH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.65 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|