C22H33N3OS — CID 28875101
1-[[(1R)-cyclohex-3-en-1-yl]methyl]-3-(2,4-dimethylphenyl)-1-(2-morpholin-4-ylethyl)thiourea (PubChem CID 28875101) has the molecular formula C22H33N3OS and a molecular weight of 387.59 g/mol. Its IUPAC name is 1-[[(1R)-cyclohex-3-en-1-yl]methyl]-3-(2,4-dimethylphenyl)-1-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 1-[[(1R)-cyclohex-3-en-1-yl]methyl]-3-(2,4-dimethylphenyl)-1-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 28875101 |
| Molecular Formula | C22H33N3OS |
| Molecular Weight | 387.59 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 1-[[(1R)-cyclohex-3-en-1-yl]methyl]-3-(2,4-dimethylphenyl)-1-(2-morpholin-4-ylethyl)thiourea |
| SMILES | Cc1ccc(NC(=S)N(CCN2CCOCC2)C[C@H]2CC=CCC2)c(C)c1 |
| InChI | InChI=1S/C22H33N3OS/c1-18-8-9-21(19(2)16-18)23-22(27)25(17-20-6-4-3-5-7-20)11-10-24-12-14-26-15-13-24/h3-4,8-9,16,20H,5-7,10-15,17H2,1-2H3,(H,23,27)/t20-/m0/s1 |
| InChIKey | IMZUWSCIMUCQIS-FQEVSTJZSA-N |
| XLogP | 3.99 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.59 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|