C21H30ClN3OS — CID 3454816
3-(4-chloro-3-methylphenyl)-1-(cyclohex-3-en-1-ylmethyl)-1-(2-morpholin-4-ylethyl)thiourea (PubChem CID 3454816) has the molecular formula C21H30ClN3OS and a molecular weight of 408.01 g/mol. Its IUPAC name is 3-(4-chloro-3-methylphenyl)-1-(cyclohex-3-en-1-ylmethyl)-1-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 3-(4-chloro-3-methylphenyl)-1-(cyclohex-3-en-1-ylmethyl)-1-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 3454816 |
| Molecular Formula | C21H30ClN3OS |
| Molecular Weight | 408.01 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 3-(4-chloro-3-methylphenyl)-1-(cyclohex-3-en-1-ylmethyl)-1-(2-morpholin-4-ylethyl)thiourea |
| SMILES | Cc1cc(NC(=S)N(CCN2CCOCC2)CC2CC=CCC2)ccc1Cl |
| InChI | InChI=1S/C21H30ClN3OS/c1-17-15-19(7-8-20(17)22)23-21(27)25(16-18-5-3-2-4-6-18)10-9-24-11-13-26-14-12-24/h2-3,7-8,15,18H,4-6,9-14,16H2,1H3,(H,23,27) |
| InChIKey | XARKASMMGSDUKV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.01 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|