C22H33N3OS — CID 4129726
1-(cyclohex-3-en-1-ylmethyl)-3-(3-methylphenyl)-1-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 4129726) has the molecular formula C22H33N3OS and a molecular weight of 387.59 g/mol. Its IUPAC name is 1-(cyclohex-3-en-1-ylmethyl)-3-(3-methylphenyl)-1-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 1-(cyclohex-3-en-1-ylmethyl)-3-(3-methylphenyl)-1-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 4129726 |
| Molecular Formula | C22H33N3OS |
| Molecular Weight | 387.59 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 1-(cyclohex-3-en-1-ylmethyl)-3-(3-methylphenyl)-1-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | Cc1cccc(NC(=S)N(CCCN2CCOCC2)CC2CC=CCC2)c1 |
| InChI | InChI=1S/C22H33N3OS/c1-19-7-5-10-21(17-19)23-22(27)25(18-20-8-3-2-4-9-20)12-6-11-24-13-15-26-16-14-24/h2-3,5,7,10,17,20H,4,6,8-9,11-16,18H2,1H3,(H,23,27) |
| InChIKey | LEYWDMHVUQVWGM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.59 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|