C25H35N3O2S — CID 5067583
1-[(4-methoxyphenyl)methyl]-3-(2-methyl-6-propan-2-ylphenyl)-1-(2-morpholin-4-ylethyl)thiourea (PubChem CID 5067583) has the molecular formula C25H35N3O2S and a molecular weight of 441.64 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-3-(2-methyl-6-propan-2-ylphenyl)-1-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-3-(2-methyl-6-propan-2-ylphenyl)-1-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 5067583 |
| Molecular Formula | C25H35N3O2S |
| Molecular Weight | 441.64 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-3-(2-methyl-6-propan-2-ylphenyl)-1-(2-morpholin-4-ylethyl)thiourea |
| SMILES | COc1ccc(CN(CCN2CCOCC2)C(=S)Nc2c(C)cccc2C(C)C)cc1 |
| InChI | InChI=1S/C25H35N3O2S/c1-19(2)23-7-5-6-20(3)24(23)26-25(31)28(13-12-27-14-16-30-17-15-27)18-21-8-10-22(29-4)11-9-21/h5-11,19H,12-18H2,1-4H3,(H,26,31) |
| InChIKey | HNVXQBCLZNUBTH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.64 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|