C16H23N — CID 55062661
N-(cyclohex-3-en-1-ylmethyl)-2-(3-methylphenyl)ethanamine (PubChem CID 55062661) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is N-(cyclohex-3-en-1-ylmethyl)-2-(3-methylphenyl)ethanamine.
| Compound Name | N-(cyclohex-3-en-1-ylmethyl)-2-(3-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 55062661 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | N-(cyclohex-3-en-1-ylmethyl)-2-(3-methylphenyl)ethanamine |
| SMILES | Cc1cccc(CCNCC2CC=CCC2)c1 |
| InChI | InChI=1S/C16H23N/c1-14-6-5-9-15(12-14)10-11-17-13-16-7-3-2-4-8-16/h2-3,5-6,9,12,16-17H,4,7-8,10-11,13H2,1H3 |
| InChIKey | RTCDYZNXHSUWHK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|