C16H23N — CID 81363043
(1R)-N-(cyclohex-3-en-1-ylmethyl)-1-(3-methylphenyl)ethanamine (PubChem CID 81363043) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is (1R)-N-(cyclohex-3-en-1-ylmethyl)-1-(3-methylphenyl)ethanamine.
| Compound Name | (1R)-N-(cyclohex-3-en-1-ylmethyl)-1-(3-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 81363043 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | (1R)-N-(cyclohex-3-en-1-ylmethyl)-1-(3-methylphenyl)ethanamine |
| SMILES | Cc1cccc([C@@H](C)NCC2CC=CCC2)c1 |
| InChI | InChI=1S/C16H23N/c1-13-7-6-10-16(11-13)14(2)17-12-15-8-4-3-5-9-15/h3-4,6-7,10-11,14-15,17H,5,8-9,12H2,1-2H3/t14-,15?/m1/s1 |
| InChIKey | OCWPAAILIAQFTG-GICMACPYSA-N |
| XLogP | 4.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|