C15H21N — CID 40641093
(1S)-N-[[(1S)-cyclohex-3-en-1-yl]methyl]-1-phenylethanamine (PubChem CID 40641093) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is (1S)-N-[[(1S)-cyclohex-3-en-1-yl]methyl]-1-phenylethanamine.
| Compound Name | (1S)-N-[[(1S)-cyclohex-3-en-1-yl]methyl]-1-phenylethanamine |
|---|---|
| PubChem CID | 40641093 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | (1S)-N-[[(1S)-cyclohex-3-en-1-yl]methyl]-1-phenylethanamine |
| SMILES | C[C@H](NC[C@@H]1CC=CCC1)c1ccccc1 |
| InChI | InChI=1S/C15H21N/c1-13(15-10-6-3-7-11-15)16-12-14-8-4-2-5-9-14/h2-4,6-7,10-11,13-14,16H,5,8-9,12H2,1H3/t13-,14+/m0/s1 |
| InChIKey | KZKNIXBYYIZQIH-UONOGXRCSA-N |
| XLogP | 3.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|