C16H22FN — CID 113226908
N-(cyclohex-3-en-1-ylmethyl)-1-(2-fluorophenyl)propan-2-amine (PubChem CID 113226908) has the molecular formula C16H22FN and a molecular weight of 247.36 g/mol. Its IUPAC name is N-(cyclohex-3-en-1-ylmethyl)-1-(2-fluorophenyl)propan-2-amine.
| Compound Name | N-(cyclohex-3-en-1-ylmethyl)-1-(2-fluorophenyl)propan-2-amine |
|---|---|
| PubChem CID | 113226908 |
| Molecular Formula | C16H22FN |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | N-(cyclohex-3-en-1-ylmethyl)-1-(2-fluorophenyl)propan-2-amine |
| SMILES | CC(Cc1ccccc1F)NCC1CC=CCC1 |
| InChI | InChI=1S/C16H22FN/c1-13(11-15-9-5-6-10-16(15)17)18-12-14-7-3-2-4-8-14/h2-3,5-6,9-10,13-14,18H,4,7-8,11-12H2,1H3 |
| InChIKey | GUXGWTCNJUXRPT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|