C17H25N — CID 43225625
N-(cyclohex-3-en-1-ylmethyl)-2-methyl-1-phenylpropan-1-amine (PubChem CID 43225625) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is N-(cyclohex-3-en-1-ylmethyl)-2-methyl-1-phenylpropan-1-amine.
| Compound Name | N-(cyclohex-3-en-1-ylmethyl)-2-methyl-1-phenylpropan-1-amine |
|---|---|
| PubChem CID | 43225625 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | N-(cyclohex-3-en-1-ylmethyl)-2-methyl-1-phenylpropan-1-amine |
| SMILES | CC(C)C(NCC1CC=CCC1)c1ccccc1 |
| InChI | InChI=1S/C17H25N/c1-14(2)17(16-11-7-4-8-12-16)18-13-15-9-5-3-6-10-15/h3-5,7-8,11-12,14-15,17-18H,6,9-10,13H2,1-2H3 |
| InChIKey | RXMIMEJBZCXOBZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|