C15H20N2O — CID 94209165
(2R)-2-[[(1S)-cyclohex-3-en-1-yl]methylamino]-2-phenylacetamide (PubChem CID 94209165) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is (2R)-2-[[(1S)-cyclohex-3-en-1-yl]methylamino]-2-phenylacetamide.
| Compound Name | (2R)-2-[[(1S)-cyclohex-3-en-1-yl]methylamino]-2-phenylacetamide |
|---|---|
| PubChem CID | 94209165 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | (2R)-2-[[(1S)-cyclohex-3-en-1-yl]methylamino]-2-phenylacetamide |
| SMILES | NC(=O)[C@H](NC[C@@H]1CC=CCC1)c1ccccc1 |
| InChI | InChI=1S/C15H20N2O/c16-15(18)14(13-9-5-2-6-10-13)17-11-12-7-3-1-4-8-12/h1-3,5-6,9-10,12,14,17H,4,7-8,11H2,(H2,16,18)/t12-,14-/m1/s1 |
| InChIKey | JFKHXPUEBHNNOM-TZMCWYRMSA-N |
| XLogP | 2.16 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|