C14H19NS — CID 43683283
N-(cyclohex-3-en-1-ylmethyl)-2-methylsulfanylaniline (PubChem CID 43683283) has the molecular formula C14H19NS and a molecular weight of 233.38 g/mol. Its IUPAC name is N-(cyclohex-3-en-1-ylmethyl)-2-methylsulfanylaniline.
| Compound Name | N-(cyclohex-3-en-1-ylmethyl)-2-methylsulfanylaniline |
|---|---|
| PubChem CID | 43683283 |
| Molecular Formula | C14H19NS |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | N-(cyclohex-3-en-1-ylmethyl)-2-methylsulfanylaniline |
| SMILES | CSc1ccccc1NCC1CC=CCC1 |
| InChI | InChI=1S/C14H19NS/c1-16-14-10-6-5-9-13(14)15-11-12-7-3-2-4-8-12/h2-3,5-6,9-10,12,15H,4,7-8,11H2,1H3 |
| InChIKey | ZLCUWKGXRVNZKS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|