C14H17F2NO — CID 43094225
N-(cyclohex-3-en-1-ylmethyl)-2-(difluoromethoxy)aniline (PubChem CID 43094225) has the molecular formula C14H17F2NO and a molecular weight of 253.29 g/mol. Its IUPAC name is N-(cyclohex-3-en-1-ylmethyl)-2-(difluoromethoxy)aniline.
| Compound Name | N-(cyclohex-3-en-1-ylmethyl)-2-(difluoromethoxy)aniline |
|---|---|
| PubChem CID | 43094225 |
| Molecular Formula | C14H17F2NO |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | N-(cyclohex-3-en-1-ylmethyl)-2-(difluoromethoxy)aniline |
| SMILES | FC(F)Oc1ccccc1NCC1CC=CCC1 |
| InChI | InChI=1S/C14H17F2NO/c15-14(16)18-13-9-5-4-8-12(13)17-10-11-6-2-1-3-7-11/h1-2,4-5,8-9,11,14,17H,3,6-7,10H2 |
| InChIKey | DXWQUSLVRMCRQX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|