C9H9F4NO — CID 60922273
N-(2,2-difluoroethyl)-2-(difluoromethoxy)aniline (PubChem CID 60922273) has the molecular formula C9H9F4NO and a molecular weight of 223.17 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-2-(difluoromethoxy)aniline.
| Compound Name | N-(2,2-difluoroethyl)-2-(difluoromethoxy)aniline |
|---|---|
| PubChem CID | 60922273 |
| Molecular Formula | C9H9F4NO |
| Molecular Weight | 223.17 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | N-(2,2-difluoroethyl)-2-(difluoromethoxy)aniline |
| SMILES | FC(F)CNc1ccccc1OC(F)F |
| InChI | InChI=1S/C9H9F4NO/c10-8(11)5-14-6-3-1-2-4-7(6)15-9(12)13/h1-4,8-9,14H,5H2 |
| InChIKey | YDRNDKBQLSRYBP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.17 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |