C15H13F4NO — CID 116788816
2-(difluoromethoxy)-N-(2,2-difluoro-2-phenylethyl)aniline (PubChem CID 116788816) has the molecular formula C15H13F4NO and a molecular weight of 299.27 g/mol. Its IUPAC name is 2-(difluoromethoxy)-N-(2,2-difluoro-2-phenylethyl)aniline.
| Compound Name | 2-(difluoromethoxy)-N-(2,2-difluoro-2-phenylethyl)aniline |
|---|---|
| PubChem CID | 116788816 |
| Molecular Formula | C15H13F4NO |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 2-(difluoromethoxy)-N-(2,2-difluoro-2-phenylethyl)aniline |
| SMILES | FC(F)Oc1ccccc1NCC(F)(F)c1ccccc1 |
| InChI | InChI=1S/C15H13F4NO/c16-14(17)21-13-9-5-4-8-12(13)20-10-15(18,19)11-6-2-1-3-7-11/h1-9,14,20H,10H2 |
| InChIKey | IPIFVHWLCGCFKJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |