C14H10F5N — CID 116788722
N-(2,2-difluoro-2-phenylethyl)-2,3,4-trifluoroaniline (PubChem CID 116788722) has the molecular formula C14H10F5N and a molecular weight of 287.23 g/mol. Its IUPAC name is N-(2,2-difluoro-2-phenylethyl)-2,3,4-trifluoroaniline.
| Compound Name | N-(2,2-difluoro-2-phenylethyl)-2,3,4-trifluoroaniline |
|---|---|
| PubChem CID | 116788722 |
| Molecular Formula | C14H10F5N |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | N-(2,2-difluoro-2-phenylethyl)-2,3,4-trifluoroaniline |
| SMILES | Fc1ccc(NCC(F)(F)c2ccccc2)c(F)c1F |
| InChI | InChI=1S/C14H10F5N/c15-10-6-7-11(13(17)12(10)16)20-8-14(18,19)9-4-2-1-3-5-9/h1-7,20H,8H2 |
| InChIKey | NMAWGPZMCJQDRC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|