C14H8F7N — CID 162537681
N-(2,2-difluoro-2-phenylethyl)-2,3,4,5,6-pentafluoroaniline (PubChem CID 162537681) has the molecular formula C14H8F7N and a molecular weight of 323.21 g/mol. Its IUPAC name is N-(2,2-difluoro-2-phenylethyl)-2,3,4,5,6-pentafluoroaniline.
| Compound Name | N-(2,2-difluoro-2-phenylethyl)-2,3,4,5,6-pentafluoroaniline |
|---|---|
| PubChem CID | 162537681 |
| Molecular Formula | C14H8F7N |
| Molecular Weight | 323.21 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | N-(2,2-difluoro-2-phenylethyl)-2,3,4,5,6-pentafluoroaniline |
| SMILES | Fc1c(F)c(F)c(NCC(F)(F)c2ccccc2)c(F)c1F |
| InChI | InChI=1S/C14H8F7N/c15-8-9(16)11(18)13(12(19)10(8)17)22-6-14(20,21)7-4-2-1-3-5-7/h1-5,22H,6H2 |
| InChIKey | HDBJSDYMWXFUFC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.21 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|