C15H14BrF2N — CID 116789222
2-bromo-N-(2,2-difluoro-2-phenylethyl)-3-methylaniline (PubChem CID 116789222) has the molecular formula C15H14BrF2N and a molecular weight of 326.18 g/mol. Its IUPAC name is 2-bromo-N-(2,2-difluoro-2-phenylethyl)-3-methylaniline.
| Compound Name | 2-bromo-N-(2,2-difluoro-2-phenylethyl)-3-methylaniline |
|---|---|
| PubChem CID | 116789222 |
| Molecular Formula | C15H14BrF2N |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | 2-bromo-N-(2,2-difluoro-2-phenylethyl)-3-methylaniline |
| SMILES | Cc1cccc(NCC(F)(F)c2ccccc2)c1Br |
| InChI | InChI=1S/C15H14BrF2N/c1-11-6-5-9-13(14(11)16)19-10-15(17,18)12-7-3-2-4-8-12/h2-9,19H,10H2,1H3 |
| InChIKey | VSCRHSWSBNXFSH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |