C14H11BrClF2N — CID 116788818
4-bromo-2-chloro-N-(2,2-difluoro-2-phenylethyl)aniline (PubChem CID 116788818) has the molecular formula C14H11BrClF2N and a molecular weight of 346.60 g/mol. Its IUPAC name is 4-bromo-2-chloro-N-(2,2-difluoro-2-phenylethyl)aniline.
| Compound Name | 4-bromo-2-chloro-N-(2,2-difluoro-2-phenylethyl)aniline |
|---|---|
| PubChem CID | 116788818 |
| Molecular Formula | C14H11BrClF2N |
| Molecular Weight | 346.60 g/mol |
| Exact Mass | 344.97 |
| IUPAC Name | 4-bromo-2-chloro-N-(2,2-difluoro-2-phenylethyl)aniline |
| SMILES | FC(F)(CNc1ccc(Br)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C14H11BrClF2N/c15-11-6-7-13(12(16)8-11)19-9-14(17,18)10-4-2-1-3-5-10/h1-8,19H,9H2 |
| InChIKey | KBUQXXYSLDQLEJ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.60 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |