C15H11BrF2N2 — CID 107789820
3-bromo-4-[(2,2-difluoro-2-phenylethyl)amino]benzonitrile (PubChem CID 107789820) has the molecular formula C15H11BrF2N2 and a molecular weight of 337.17 g/mol. Its IUPAC name is 3-bromo-4-[(2,2-difluoro-2-phenylethyl)amino]benzonitrile.
| Compound Name | 3-bromo-4-[(2,2-difluoro-2-phenylethyl)amino]benzonitrile |
|---|---|
| PubChem CID | 107789820 |
| Molecular Formula | C15H11BrF2N2 |
| Molecular Weight | 337.17 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | 3-bromo-4-[(2,2-difluoro-2-phenylethyl)amino]benzonitrile |
| SMILES | N#Cc1ccc(NCC(F)(F)c2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C15H11BrF2N2/c16-13-8-11(9-19)6-7-14(13)20-10-15(17,18)12-4-2-1-3-5-12/h1-8,20H,10H2 |
| InChIKey | YROIVMDUCRBCNX-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.17 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |