C11H9BrF3N3O — CID 103865855
2-(2-bromo-4-cyanoanilino)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 103865855) has the molecular formula C11H9BrF3N3O and a molecular weight of 336.11 g/mol. Its IUPAC name is 2-(2-bromo-4-cyanoanilino)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(2-bromo-4-cyanoanilino)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 103865855 |
| Molecular Formula | C11H9BrF3N3O |
| Molecular Weight | 336.11 g/mol |
| Exact Mass | 334.99 |
| IUPAC Name | 2-(2-bromo-4-cyanoanilino)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | N#Cc1ccc(NCC(=O)NCC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C11H9BrF3N3O/c12-8-3-7(4-16)1-2-9(8)17-5-10(19)18-6-11(13,14)15/h1-3,17H,5-6H2,(H,18,19) |
| InChIKey | YOWSVDBYDVRWJZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.11 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |