C10H9BrF4N2O — CID 60688294
2-(4-bromo-2-fluoroanilino)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 60688294) has the molecular formula C10H9BrF4N2O and a molecular weight of 329.09 g/mol. Its IUPAC name is 2-(4-bromo-2-fluoroanilino)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(4-bromo-2-fluoroanilino)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 60688294 |
| Molecular Formula | C10H9BrF4N2O |
| Molecular Weight | 329.09 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | 2-(4-bromo-2-fluoroanilino)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(CNc1ccc(Br)cc1F)NCC(F)(F)F |
| InChI | InChI=1S/C10H9BrF4N2O/c11-6-1-2-8(7(12)3-6)16-4-9(18)17-5-10(13,14)15/h1-3,16H,4-5H2,(H,17,18) |
| InChIKey | QFDBXMGNLHIAKF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.09 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |