About 6-chloro-N-(2,2-difluoro-2-phenylethyl)-3-ethyl-2-methylaniline;ethanamine
6-chloro-N-(2,2-difluoro-2-phenylethyl)-3-ethyl-2-methylaniline;ethanamine (PubChem CID 143097472) has the molecular formula C19H25ClF2N2
and a molecular weight of 354.87 g/mol. Its IUPAC name is 6-chloro-N-(2,2-difluoro-2-phenylethyl)-3-ethyl-2-methylaniline;ethanamine.
Molecular Properties
| Compound Name | 6-chloro-N-(2,2-difluoro-2-phenylethyl)-3-ethyl-2-methylaniline;ethanamine |
| PubChem CID | 143097472 |
| Molecular Formula | C19H25ClF2N2 |
| Molecular Weight | 354.87 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 6-chloro-N-(2,2-difluoro-2-phenylethyl)-3-ethyl-2-methylaniline;ethanamine |
| SMILES | CCN.CCc1ccc(Cl)c(NCC(F)(F)c2ccccc2)c1C |
| InChI | InChI=1S/C17H18ClF2N.C2H7N/c1-3-13-9-10-15(18)16(12(13)2)21-11-17(19,20)14-7-5-4-6-8-14;1-2-3/h4-10,21H,3,11H2,1-2H3;2-3H2,1H3 |
| InChIKey | FENNRPPOWXUJQM-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.87 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-chloro-N-(2,2-difluoro-2-phenylethyl)-3-ethyl-2-methylaniline;ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-(2,2-difluoro-2-phenylethyl)-3-ethyl-2-methylaniline;ethanamine?
The IUPAC name of 6-chloro-N-(2,2-difluoro-2-phenylethyl)-3-ethyl-2-methylaniline;ethanamine (CID 143097472) is 6-chloro-N-(2,2-difluoro-2-phenylethyl)-3-ethyl-2-methylaniline;ethanamine.
What is the SMILES notation for 6-chloro-N-(2,2-difluoro-2-phenylethyl)-3-ethyl-2-methylaniline;ethanamine?
The canonical SMILES for 6-chloro-N-(2,2-difluoro-2-phenylethyl)-3-ethyl-2-methylaniline;ethanamine is CCN.CCc1ccc(Cl)c(NCC(F)(F)c2ccccc2)c1C.
What is the InChIKey of 6-chloro-N-(2,2-difluoro-2-phenylethyl)-3-ethyl-2-methylaniline;ethanamine?
The InChIKey is FENNRPPOWXUJQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18ClF2N.C2H7N/c1-3-13-9-10-15(18)16(12(13)2)21-11-17(19,20)14-7-5-4-6-8-14;1-2-3/h4-10,21H,3,11H2,1-2H3;2-3H2,1H3.
What are the key properties of 6-chloro-N-(2,2-difluoro-2-phenylethyl)-3-ethyl-2-methylaniline;ethanamine?
6-chloro-N-(2,2-difluoro-2-phenylethyl)-3-ethyl-2-methylaniline;ethanamine has a molecular weight of 354.87 g/mol, XLogP of 5.38, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-(2,2-difluoro-2-phenylethyl)-3-ethyl-2-methylaniline;ethanamine is sourced from PubChem (CID 143097472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).