C16H25F2N — CID 116788975
N-(2,2-difluoro-2-phenylethyl)-2,4,4-trimethylpentan-2-amine (PubChem CID 116788975) has the molecular formula C16H25F2N and a molecular weight of 269.38 g/mol. Its IUPAC name is N-(2,2-difluoro-2-phenylethyl)-2,4,4-trimethylpentan-2-amine.
| Compound Name | N-(2,2-difluoro-2-phenylethyl)-2,4,4-trimethylpentan-2-amine |
|---|---|
| PubChem CID | 116788975 |
| Molecular Formula | C16H25F2N |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | N-(2,2-difluoro-2-phenylethyl)-2,4,4-trimethylpentan-2-amine |
| SMILES | CC(C)(C)CC(C)(C)NCC(F)(F)c1ccccc1 |
| InChI | InChI=1S/C16H25F2N/c1-14(2,3)11-15(4,5)19-12-16(17,18)13-9-7-6-8-10-13/h6-10,19H,11-12H2,1-5H3 |
| InChIKey | MHOIGRREKQRICB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |