C14H16ClF2NO — CID 43104519
3-chloro-N-(cyclohex-3-en-1-ylmethyl)-4-(difluoromethoxy)aniline (PubChem CID 43104519) has the molecular formula C14H16ClF2NO and a molecular weight of 287.74 g/mol. Its IUPAC name is 3-chloro-N-(cyclohex-3-en-1-ylmethyl)-4-(difluoromethoxy)aniline.
| Compound Name | 3-chloro-N-(cyclohex-3-en-1-ylmethyl)-4-(difluoromethoxy)aniline |
|---|---|
| PubChem CID | 43104519 |
| Molecular Formula | C14H16ClF2NO |
| Molecular Weight | 287.74 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 3-chloro-N-(cyclohex-3-en-1-ylmethyl)-4-(difluoromethoxy)aniline |
| SMILES | FC(F)Oc1ccc(NCC2CC=CCC2)cc1Cl |
| InChI | InChI=1S/C14H16ClF2NO/c15-12-8-11(6-7-13(12)19-14(16)17)18-9-10-4-2-1-3-5-10/h1-2,6-8,10,14,18H,3-5,9H2 |
| InChIKey | GJZATHFYXDBDBJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.74 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|