C15H21ClN2 — CID 55191974
2-chloro-4-N-(cyclohex-3-en-1-ylmethyl)-1-N,1-N-dimethylbenzene-1,4-diamine (PubChem CID 55191974) has the molecular formula C15H21ClN2 and a molecular weight of 264.80 g/mol. Its IUPAC name is 2-chloro-4-N-(cyclohex-3-en-1-ylmethyl)-1-N,1-N-dimethylbenzene-1,4-diamine.
| Compound Name | 2-chloro-4-N-(cyclohex-3-en-1-ylmethyl)-1-N,1-N-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 55191974 |
| Molecular Formula | C15H21ClN2 |
| Molecular Weight | 264.80 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 2-chloro-4-N-(cyclohex-3-en-1-ylmethyl)-1-N,1-N-dimethylbenzene-1,4-diamine |
| SMILES | CN(C)c1ccc(NCC2CC=CCC2)cc1Cl |
| InChI | InChI=1S/C15H21ClN2/c1-18(2)15-9-8-13(10-14(15)16)17-11-12-6-4-3-5-7-12/h3-4,8-10,12,17H,5-7,11H2,1-2H3 |
| InChIKey | BMSFDCJPIPSLIG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.80 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|