C13H17ClF2N2O — CID 80553653
3-chloro-4-(difluoromethoxy)-N-(piperidin-3-ylmethyl)aniline (PubChem CID 80553653) has the molecular formula C13H17ClF2N2O and a molecular weight of 290.74 g/mol. Its IUPAC name is 3-chloro-4-(difluoromethoxy)-N-(piperidin-3-ylmethyl)aniline.
| Compound Name | 3-chloro-4-(difluoromethoxy)-N-(piperidin-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 80553653 |
| Molecular Formula | C13H17ClF2N2O |
| Molecular Weight | 290.74 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 3-chloro-4-(difluoromethoxy)-N-(piperidin-3-ylmethyl)aniline |
| SMILES | FC(F)Oc1ccc(NCC2CCCNC2)cc1Cl |
| InChI | InChI=1S/C13H17ClF2N2O/c14-11-6-10(3-4-12(11)19-13(15)16)18-8-9-2-1-5-17-7-9/h3-4,6,9,13,17-18H,1-2,5,7-8H2 |
| InChIKey | RINSCGFNFGSQCF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.74 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|